C17H19N5S — CID 133407874
4-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]pyrido[2,3-d]pyrimidine-4,7-diamine (PubChem CID 133407874) has the molecular formula C17H19N5S and a molecular weight of 325.44 g/mol. Its IUPAC name is 4-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]pyrido[2,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]pyrido[2,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 133407874 |
| Molecular Formula | C17H19N5S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]pyrido[2,3-d]pyrimidine-4,7-diamine |
| SMILES | Cc1ccc(CSCCNc2ncnc3nc(N)ccc23)cc1 |
| InChI | InChI=1S/C17H19N5S/c1-12-2-4-13(5-3-12)10-23-9-8-19-16-14-6-7-15(18)22-17(14)21-11-20-16/h2-7,11H,8-10H2,1H3,(H3,18,19,20,21,22) |
| InChIKey | YAJHBKZQRLIMRO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|