C11H13N5 — CID 133408710
4-N-(cyclopropylmethyl)pyrido[2,3-d]pyrimidine-4,7-diamine (PubChem CID 133408710) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 4-N-(cyclopropylmethyl)pyrido[2,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-(cyclopropylmethyl)pyrido[2,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 133408710 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 4-N-(cyclopropylmethyl)pyrido[2,3-d]pyrimidine-4,7-diamine |
| SMILES | Nc1ccc2c(NCC3CC3)ncnc2n1 |
| InChI | InChI=1S/C11H13N5/c12-9-4-3-8-10(13-5-7-1-2-7)14-6-15-11(8)16-9/h3-4,6-7H,1-2,5H2,(H3,12,13,14,15,16) |
| InChIKey | NBUUPGRBEYHPSM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |