C15H14ClN5O — CID 133409618
4-N-[2-(3-chlorophenoxy)ethyl]pyrido[2,3-d]pyrimidine-4,7-diamine (PubChem CID 133409618) has the molecular formula C15H14ClN5O and a molecular weight of 315.76 g/mol. Its IUPAC name is 4-N-[2-(3-chlorophenoxy)ethyl]pyrido[2,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-[2-(3-chlorophenoxy)ethyl]pyrido[2,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 133409618 |
| Molecular Formula | C15H14ClN5O |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-N-[2-(3-chlorophenoxy)ethyl]pyrido[2,3-d]pyrimidine-4,7-diamine |
| SMILES | Nc1ccc2c(NCCOc3cccc(Cl)c3)ncnc2n1 |
| InChI | InChI=1S/C15H14ClN5O/c16-10-2-1-3-11(8-10)22-7-6-18-14-12-4-5-13(17)21-15(12)20-9-19-14/h1-5,8-9H,6-7H2,(H3,17,18,19,20,21) |
| InChIKey | KXEZSPUMNRDRMM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|