C15H15N5S — CID 133407916
4-N-(2-phenylsulfanylethyl)pyrido[2,3-d]pyrimidine-4,7-diamine (PubChem CID 133407916) has the molecular formula C15H15N5S and a molecular weight of 297.39 g/mol. Its IUPAC name is 4-N-(2-phenylsulfanylethyl)pyrido[2,3-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-(2-phenylsulfanylethyl)pyrido[2,3-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 133407916 |
| Molecular Formula | C15H15N5S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-N-(2-phenylsulfanylethyl)pyrido[2,3-d]pyrimidine-4,7-diamine |
| SMILES | Nc1ccc2c(NCCSc3ccccc3)ncnc2n1 |
| InChI | InChI=1S/C15H15N5S/c16-13-7-6-12-14(18-10-19-15(12)20-13)17-8-9-21-11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H3,16,17,18,19,20) |
| InChIKey | INSIAPRKTNYFOG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|