C16H17N7O3 — CID 133412433
N-(3-methoxy-4-nitrophenyl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine (PubChem CID 133412433) has the molecular formula C16H17N7O3 and a molecular weight of 355.36 g/mol. Its IUPAC name is N-(3-methoxy-4-nitrophenyl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine.
| Compound Name | N-(3-methoxy-4-nitrophenyl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 133412433 |
| Molecular Formula | C16H17N7O3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-(3-methoxy-4-nitrophenyl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine |
| SMILES | COc1cc(NCCNc2nnnn2-c2ccccc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N7O3/c1-26-15-11-12(7-8-14(15)23(24)25)17-9-10-18-16-19-20-21-22(16)13-5-3-2-4-6-13/h2-8,11,17H,9-10H2,1H3,(H,18,19,21) |
| InChIKey | IGCGLQPDMXAXLN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|