C13H13F3N4O4S — CID 133414537
3-methylsulfonyl-N-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-2-nitroaniline (PubChem CID 133414537) has the molecular formula C13H13F3N4O4S and a molecular weight of 378.33 g/mol. Its IUPAC name is 3-methylsulfonyl-N-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-2-nitroaniline.
| Compound Name | 3-methylsulfonyl-N-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-2-nitroaniline |
|---|---|
| PubChem CID | 133414537 |
| Molecular Formula | C13H13F3N4O4S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 3-methylsulfonyl-N-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-2-nitroaniline |
| SMILES | Cn1cc(CNc2cccc(S(C)(=O)=O)c2[N+](=O)[O-])c(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H13F3N4O4S/c1-19-7-8(12(18-19)13(14,15)16)6-17-9-4-3-5-10(25(2,23)24)11(9)20(21)22/h3-5,7,17H,6H2,1-2H3 |
| InChIKey | ZMGOJWUYIFDIJI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|