C16H18Cl2N4S — CID 133416150
4-chloro-6-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-cyclopropylpyrimidine (PubChem CID 133416150) has the molecular formula C16H18Cl2N4S and a molecular weight of 369.32 g/mol. Its IUPAC name is 4-chloro-6-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-cyclopropylpyrimidine.
| Compound Name | 4-chloro-6-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-cyclopropylpyrimidine |
|---|---|
| PubChem CID | 133416150 |
| Molecular Formula | C16H18Cl2N4S |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-chloro-6-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-2-cyclopropylpyrimidine |
| SMILES | Clc1cc(N2CCN(Cc3ccc(Cl)s3)CC2)nc(C2CC2)n1 |
| InChI | InChI=1S/C16H18Cl2N4S/c17-13-9-15(20-16(19-13)11-1-2-11)22-7-5-21(6-8-22)10-12-3-4-14(18)23-12/h3-4,9,11H,1-2,5-8,10H2 |
| InChIKey | JPBZNIHIFMRIDG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |