C20H24ClN5O — CID 133433117
N-benzyl-2-[4-(6-chloro-2-cyclopropylpyrimidin-4-yl)piperazin-1-yl]acetamide (PubChem CID 133433117) has the molecular formula C20H24ClN5O and a molecular weight of 385.90 g/mol. Its IUPAC name is N-benzyl-2-[4-(6-chloro-2-cyclopropylpyrimidin-4-yl)piperazin-1-yl]acetamide.
| Compound Name | N-benzyl-2-[4-(6-chloro-2-cyclopropylpyrimidin-4-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 133433117 |
| Molecular Formula | C20H24ClN5O |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N-benzyl-2-[4-(6-chloro-2-cyclopropylpyrimidin-4-yl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2cc(Cl)nc(C3CC3)n2)CC1)NCc1ccccc1 |
| InChI | InChI=1S/C20H24ClN5O/c21-17-12-18(24-20(23-17)16-6-7-16)26-10-8-25(9-11-26)14-19(27)22-13-15-4-2-1-3-5-15/h1-5,12,16H,6-11,13-14H2,(H,22,27) |
| InChIKey | HXXKDFMOACWUBF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |