C20H22ClN3O2 — CID 133421842
methyl 1-(6-chloro-2-cyclopropylpyrimidin-4-yl)-5-phenylpiperidine-3-carboxylate (PubChem CID 133421842) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is methyl 1-(6-chloro-2-cyclopropylpyrimidin-4-yl)-5-phenylpiperidine-3-carboxylate.
| Compound Name | methyl 1-(6-chloro-2-cyclopropylpyrimidin-4-yl)-5-phenylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 133421842 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | methyl 1-(6-chloro-2-cyclopropylpyrimidin-4-yl)-5-phenylpiperidine-3-carboxylate |
| SMILES | COC(=O)C1CC(c2ccccc2)CN(c2cc(Cl)nc(C3CC3)n2)C1 |
| InChI | InChI=1S/C20H22ClN3O2/c1-26-20(25)16-9-15(13-5-3-2-4-6-13)11-24(12-16)18-10-17(21)22-19(23-18)14-7-8-14/h2-6,10,14-16H,7-9,11-12H2,1H3 |
| InChIKey | ZFBDCINHDBKWGI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |