C17H24ClN3O2 — CID 133444450
methyl 2-[1-(6-chloro-2-cyclopropylpyrimidin-4-yl)piperidin-3-yl]-2-methylpropanoate (PubChem CID 133444450) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is methyl 2-[1-(6-chloro-2-cyclopropylpyrimidin-4-yl)piperidin-3-yl]-2-methylpropanoate.
| Compound Name | methyl 2-[1-(6-chloro-2-cyclopropylpyrimidin-4-yl)piperidin-3-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 133444450 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | methyl 2-[1-(6-chloro-2-cyclopropylpyrimidin-4-yl)piperidin-3-yl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)C1CCCN(c2cc(Cl)nc(C3CC3)n2)C1 |
| InChI | InChI=1S/C17H24ClN3O2/c1-17(2,16(22)23-3)12-5-4-8-21(10-12)14-9-13(18)19-15(20-14)11-6-7-11/h9,11-12H,4-8,10H2,1-3H3 |
| InChIKey | JPIIJMSNHNLPCZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |