C16H21F3N2O2 — CID 133444594
methyl 2-methyl-2-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propanoate (PubChem CID 133444594) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is methyl 2-methyl-2-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propanoate.
| Compound Name | methyl 2-methyl-2-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propanoate |
|---|---|
| PubChem CID | 133444594 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | methyl 2-methyl-2-[1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propanoate |
| SMILES | COC(=O)C(C)(C)C1CCCN(c2cccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C16H21F3N2O2/c1-15(2,14(22)23-3)11-6-5-9-21(10-11)13-8-4-7-12(20-13)16(17,18)19/h4,7-8,11H,5-6,9-10H2,1-3H3 |
| InChIKey | PXUDAZHMPYOXPU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |