C22H28F3N3O — CID 147857261
N-[(3S)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]adamantane-1-carboxamide (PubChem CID 147857261) has the molecular formula C22H28F3N3O and a molecular weight of 407.48 g/mol. Its IUPAC name is N-[(3S)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-[(3S)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 147857261 |
| Molecular Formula | C22H28F3N3O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-[(3S)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]adamantane-1-carboxamide |
| SMILES | O=C(N[C@H]1CCCN(c2cccc(C(F)(F)F)n2)C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H28F3N3O/c23-22(24,25)18-4-1-5-19(27-18)28-6-2-3-17(13-28)26-20(29)21-10-14-7-15(11-21)9-16(8-14)12-21/h1,4-5,14-17H,2-3,6-13H2,(H,26,29)/t14?,15?,16?,17-,21?/m0/s1 |
| InChIKey | HVZAVSRGZHBSMS-HQHQJUQOSA-N |
| XLogP | 4.40 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |