C18H19F2N5 — CID 133418207
6-ethyl-5-fluoro-N-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]pyrimidin-4-amine (PubChem CID 133418207) has the molecular formula C18H19F2N5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 6-ethyl-5-fluoro-N-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]pyrimidin-4-amine.
| Compound Name | 6-ethyl-5-fluoro-N-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133418207 |
| Molecular Formula | C18H19F2N5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 6-ethyl-5-fluoro-N-[1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]ethyl]pyrimidin-4-amine |
| SMILES | CCc1ncnc(NC(C)c2cnn(-c3ccc(F)cc3)c2C)c1F |
| InChI | InChI=1S/C18H19F2N5/c1-4-16-17(20)18(22-10-21-16)24-11(2)15-9-23-25(12(15)3)14-7-5-13(19)6-8-14/h5-11H,4H2,1-3H3,(H,21,22,24) |
| InChIKey | XFWPELOZNYUKMS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |