C18H19FN4 — CID 94962214
(1S)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-N-(pyridin-2-ylmethyl)ethanamine (PubChem CID 94962214) has the molecular formula C18H19FN4 and a molecular weight of 310.38 g/mol. Its IUPAC name is (1S)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-N-(pyridin-2-ylmethyl)ethanamine.
| Compound Name | (1S)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-N-(pyridin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 94962214 |
| Molecular Formula | C18H19FN4 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (1S)-1-[1-(4-fluorophenyl)-5-methylpyrazol-4-yl]-N-(pyridin-2-ylmethyl)ethanamine |
| SMILES | Cc1c([C@H](C)NCc2ccccn2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H19FN4/c1-13(21-11-16-5-3-4-10-20-16)18-12-22-23(14(18)2)17-8-6-15(19)7-9-17/h3-10,12-13,21H,11H2,1-2H3/t13-/m0/s1 |
| InChIKey | KWKVMKBNYKIMRY-ZDUSSCGKSA-N |
| XLogP | 3.57 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |