C22H23N5 — CID 45219969
1-(5-methyl-1-phenylpyrazol-4-yl)-N-[(1-pyridin-2-ylpyrrol-2-yl)methyl]ethanamine (PubChem CID 45219969) has the molecular formula C22H23N5 and a molecular weight of 357.46 g/mol. Its IUPAC name is 1-(5-methyl-1-phenylpyrazol-4-yl)-N-[(1-pyridin-2-ylpyrrol-2-yl)methyl]ethanamine.
| Compound Name | 1-(5-methyl-1-phenylpyrazol-4-yl)-N-[(1-pyridin-2-ylpyrrol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 45219969 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 1-(5-methyl-1-phenylpyrazol-4-yl)-N-[(1-pyridin-2-ylpyrrol-2-yl)methyl]ethanamine |
| SMILES | Cc1c(C(C)NCc2cccn2-c2ccccn2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C22H23N5/c1-17(21-16-25-27(18(21)2)19-9-4-3-5-10-19)24-15-20-11-8-14-26(20)22-12-6-7-13-23-22/h3-14,16-17,24H,15H2,1-2H3 |
| InChIKey | GIAAQMCYMGUZLP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |