C20H23N3S — CID 25384796
(1R)-1-(5-methyl-1-phenylpyrazol-4-yl)-N-[(4-methylsulfanylphenyl)methyl]ethanamine (PubChem CID 25384796) has the molecular formula C20H23N3S and a molecular weight of 337.49 g/mol. Its IUPAC name is (1R)-1-(5-methyl-1-phenylpyrazol-4-yl)-N-[(4-methylsulfanylphenyl)methyl]ethanamine.
| Compound Name | (1R)-1-(5-methyl-1-phenylpyrazol-4-yl)-N-[(4-methylsulfanylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 25384796 |
| Molecular Formula | C20H23N3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | (1R)-1-(5-methyl-1-phenylpyrazol-4-yl)-N-[(4-methylsulfanylphenyl)methyl]ethanamine |
| SMILES | CSc1ccc(CN[C@H](C)c2cnn(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C20H23N3S/c1-15(21-13-17-9-11-19(24-3)12-10-17)20-14-22-23(16(20)2)18-7-5-4-6-8-18/h4-12,14-15,21H,13H2,1-3H3/t15-/m1/s1 |
| InChIKey | WMZBWIORRJQFOR-OAHLLOKOSA-N |
| XLogP | 4.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |