C20H24F3N5 — CID 133422697
N-[[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]methyl]-6-(trifluoromethyl)pyridazin-3-amine (PubChem CID 133422697) has the molecular formula C20H24F3N5 and a molecular weight of 391.44 g/mol. Its IUPAC name is N-[[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]methyl]-6-(trifluoromethyl)pyridazin-3-amine.
| Compound Name | N-[[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]methyl]-6-(trifluoromethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 133422697 |
| Molecular Formula | C20H24F3N5 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N-[[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]methyl]-6-(trifluoromethyl)pyridazin-3-amine |
| SMILES | FC(F)(F)c1ccc(NCc2ccc(N3CCN(CC4CC4)CC3)cc2)nn1 |
| InChI | InChI=1S/C20H24F3N5/c21-20(22,23)18-7-8-19(26-25-18)24-13-15-3-5-17(6-4-15)28-11-9-27(10-12-28)14-16-1-2-16/h3-8,16H,1-2,9-14H2,(H,24,26) |
| InChIKey | DONZMVABPZINRO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|