C21H30N6 — CID 133422665
2-N-[[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]methyl]-4-N,4-N-dimethylpyrimidine-2,4-diamine (PubChem CID 133422665) has the molecular formula C21H30N6 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-N-[[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]methyl]-4-N,4-N-dimethylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]methyl]-4-N,4-N-dimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133422665 |
| Molecular Formula | C21H30N6 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 2-N-[[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]methyl]-4-N,4-N-dimethylpyrimidine-2,4-diamine |
| SMILES | CN(C)c1ccnc(NCc2ccc(N3CCN(CC4CC4)CC3)cc2)n1 |
| InChI | InChI=1S/C21H30N6/c1-25(2)20-9-10-22-21(24-20)23-15-17-5-7-19(8-6-17)27-13-11-26(12-14-27)16-18-3-4-18/h5-10,18H,3-4,11-16H2,1-2H3,(H,22,23,24) |
| InChIKey | SZJWRYWDXSBTMW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|