C20H26N6O — CID 133422716
6-[[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]methylamino]pyrazine-2-carboxamide (PubChem CID 133422716) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is 6-[[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]methylamino]pyrazine-2-carboxamide.
| Compound Name | 6-[[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]methylamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 133422716 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 6-[[4-[4-(cyclopropylmethyl)piperazin-1-yl]phenyl]methylamino]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1cncc(NCc2ccc(N3CCN(CC4CC4)CC3)cc2)n1 |
| InChI | InChI=1S/C20H26N6O/c21-20(27)18-12-22-13-19(24-18)23-11-15-3-5-17(6-4-15)26-9-7-25(8-10-26)14-16-1-2-16/h3-6,12-13,16H,1-2,7-11,14H2,(H2,21,27)(H,23,24) |
| InChIKey | JKGVXZJEKIUQIP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|