C15H17N5O — CID 133423320
N,5,6-trimethyl-N-phenylmethoxy-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 133423320) has the molecular formula C15H17N5O and a molecular weight of 283.33 g/mol. Its IUPAC name is N,5,6-trimethyl-N-phenylmethoxy-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N,5,6-trimethyl-N-phenylmethoxy-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 133423320 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N,5,6-trimethyl-N-phenylmethoxy-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1nc2ncnn2c(N(C)OCc2ccccc2)c1C |
| InChI | InChI=1S/C15H17N5O/c1-11-12(2)18-15-16-10-17-20(15)14(11)19(3)21-9-13-7-5-4-6-8-13/h4-8,10H,9H2,1-3H3 |
| InChIKey | DPPICFBXXCOOSU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|