C14H16N2O2S — CID 133424742
3-cyclopropyl-5-[4-(2-methoxyethyl)phenoxy]-1,2,4-thiadiazole (PubChem CID 133424742) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-cyclopropyl-5-[4-(2-methoxyethyl)phenoxy]-1,2,4-thiadiazole.
| Compound Name | 3-cyclopropyl-5-[4-(2-methoxyethyl)phenoxy]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 133424742 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 3-cyclopropyl-5-[4-(2-methoxyethyl)phenoxy]-1,2,4-thiadiazole |
| SMILES | COCCc1ccc(Oc2nc(C3CC3)ns2)cc1 |
| InChI | InChI=1S/C14H16N2O2S/c1-17-9-8-10-2-6-12(7-3-10)18-14-15-13(16-19-14)11-4-5-11/h2-3,6-7,11H,4-5,8-9H2,1H3 |
| InChIKey | VDWCHOCQORYWNY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |