C14H18N2O2S — CID 104952806
2-[4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]ethanol (PubChem CID 104952806) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-[4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]ethanol.
| Compound Name | 2-[4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]ethanol |
|---|---|
| PubChem CID | 104952806 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-[4-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]phenyl]ethanol |
| SMILES | CC(C)(C)c1nsc(Oc2ccc(CCO)cc2)n1 |
| InChI | InChI=1S/C14H18N2O2S/c1-14(2,3)12-15-13(19-16-12)18-11-6-4-10(5-7-11)8-9-17/h4-7,17H,8-9H2,1-3H3 |
| InChIKey | IPXXFTZBXHPFFL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |