C15H10F2N2O — CID 133425127
4-(3,4-difluorophenoxy)-6-methylquinazoline (PubChem CID 133425127) has the molecular formula C15H10F2N2O and a molecular weight of 272.25 g/mol. Its IUPAC name is 4-(3,4-difluorophenoxy)-6-methylquinazoline.
| Compound Name | 4-(3,4-difluorophenoxy)-6-methylquinazoline |
|---|---|
| PubChem CID | 133425127 |
| Molecular Formula | C15H10F2N2O |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-(3,4-difluorophenoxy)-6-methylquinazoline |
| SMILES | Cc1ccc2ncnc(Oc3ccc(F)c(F)c3)c2c1 |
| InChI | InChI=1S/C15H10F2N2O/c1-9-2-5-14-11(6-9)15(19-8-18-14)20-10-3-4-12(16)13(17)7-10/h2-8H,1H3 |
| InChIKey | QNIRORJAIRCHFB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |