C13H14N2OS — CID 133425169
3-ethyl-5-(2-prop-2-enylphenoxy)-1,2,4-thiadiazole (PubChem CID 133425169) has the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. Its IUPAC name is 3-ethyl-5-(2-prop-2-enylphenoxy)-1,2,4-thiadiazole.
| Compound Name | 3-ethyl-5-(2-prop-2-enylphenoxy)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 133425169 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-ethyl-5-(2-prop-2-enylphenoxy)-1,2,4-thiadiazole |
| SMILES | C=CCc1ccccc1Oc1nc(CC)ns1 |
| InChI | InChI=1S/C13H14N2OS/c1-3-7-10-8-5-6-9-11(10)16-13-14-12(4-2)15-17-13/h3,5-6,8-9H,1,4,7H2,2H3 |
| InChIKey | CHWBSMNWFAODPB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|