C14H13ClN2OS — CID 133428131
6-chloro-2-(3-hydroxybutan-2-ylsulfanyl)quinoline-4-carbonitrile (PubChem CID 133428131) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is 6-chloro-2-(3-hydroxybutan-2-ylsulfanyl)quinoline-4-carbonitrile.
| Compound Name | 6-chloro-2-(3-hydroxybutan-2-ylsulfanyl)quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133428131 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 6-chloro-2-(3-hydroxybutan-2-ylsulfanyl)quinoline-4-carbonitrile |
| SMILES | CC(O)C(C)Sc1cc(C#N)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C14H13ClN2OS/c1-8(18)9(2)19-14-5-10(7-16)12-6-11(15)3-4-13(12)17-14/h3-6,8-9,18H,1-2H3 |
| InChIKey | WQYYYSIGJDXDJN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |