C19H15ClN4O2S2 — CID 133426254
6-chloro-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]quinoline-4-carbonitrile (PubChem CID 133426254) has the molecular formula C19H15ClN4O2S2 and a molecular weight of 430.94 g/mol. Its IUPAC name is 6-chloro-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]quinoline-4-carbonitrile.
| Compound Name | 6-chloro-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133426254 |
| Molecular Formula | C19H15ClN4O2S2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 6-chloro-2-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]quinoline-4-carbonitrile |
| SMILES | N#Cc1cc(Sc2ccc(S(=O)(=O)N3CCCC3)cn2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H15ClN4O2S2/c20-14-3-5-17-16(10-14)13(11-21)9-19(23-17)27-18-6-4-15(12-22-18)28(25,26)24-7-1-2-8-24/h3-6,9-10,12H,1-2,7-8H2 |
| InChIKey | USARMZYICJVKOY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 86.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |