C15H14ClN5O3 — CID 133432313
N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine (PubChem CID 133432313) has the molecular formula C15H14ClN5O3 and a molecular weight of 347.76 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133432313 |
| Molecular Formula | C15H14ClN5O3 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-3-nitroimidazo[1,2-b]pyridazin-6-amine |
| SMILES | COc1ccc(Cl)cc1CN(C)c1ccc2ncc([N+](=O)[O-])n2n1 |
| InChI | InChI=1S/C15H14ClN5O3/c1-19(9-10-7-11(16)3-4-12(10)24-2)14-6-5-13-17-8-15(21(22)23)20(13)18-14/h3-8H,9H2,1-2H3 |
| InChIKey | IGJXCBIZRHUQKS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|