C14H18N4O3 — CID 18095996
N-[(2-methoxy-5-methylphenyl)methyl]-N,3-dimethyl-5-nitroimidazol-4-amine (PubChem CID 18095996) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[(2-methoxy-5-methylphenyl)methyl]-N,3-dimethyl-5-nitroimidazol-4-amine.
| Compound Name | N-[(2-methoxy-5-methylphenyl)methyl]-N,3-dimethyl-5-nitroimidazol-4-amine |
|---|---|
| PubChem CID | 18095996 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-[(2-methoxy-5-methylphenyl)methyl]-N,3-dimethyl-5-nitroimidazol-4-amine |
| SMILES | COc1ccc(C)cc1CN(C)c1c([N+](=O)[O-])ncn1C |
| InChI | InChI=1S/C14H18N4O3/c1-10-5-6-12(21-4)11(7-10)8-16(2)14-13(18(19)20)15-9-17(14)3/h5-7,9H,8H2,1-4H3 |
| InChIKey | CWRGJGGTKRFBFW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|