C16H17N3O4S — CID 133435611
1-methyl-N-(3-methylsulfonyl-2-nitrophenyl)-2,3-dihydroindol-6-amine (PubChem CID 133435611) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 1-methyl-N-(3-methylsulfonyl-2-nitrophenyl)-2,3-dihydroindol-6-amine.
| Compound Name | 1-methyl-N-(3-methylsulfonyl-2-nitrophenyl)-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 133435611 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-methyl-N-(3-methylsulfonyl-2-nitrophenyl)-2,3-dihydroindol-6-amine |
| SMILES | CN1CCc2ccc(Nc3cccc(S(C)(=O)=O)c3[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H17N3O4S/c1-18-9-8-11-6-7-12(10-14(11)18)17-13-4-3-5-15(24(2,22)23)16(13)19(20)21/h3-7,10,17H,8-9H2,1-2H3 |
| InChIKey | ZJCQJPGHHSATDB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|