C12H16BrFN2O2 — CID 133441604
4-bromo-2-fluoro-6-[3-hydroxybutyl(methyl)amino]benzamide (PubChem CID 133441604) has the molecular formula C12H16BrFN2O2 and a molecular weight of 319.17 g/mol. Its IUPAC name is 4-bromo-2-fluoro-6-[3-hydroxybutyl(methyl)amino]benzamide.
| Compound Name | 4-bromo-2-fluoro-6-[3-hydroxybutyl(methyl)amino]benzamide |
|---|---|
| PubChem CID | 133441604 |
| Molecular Formula | C12H16BrFN2O2 |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 4-bromo-2-fluoro-6-[3-hydroxybutyl(methyl)amino]benzamide |
| SMILES | CC(O)CCN(C)c1cc(Br)cc(F)c1C(N)=O |
| InChI | InChI=1S/C12H16BrFN2O2/c1-7(17)3-4-16(2)10-6-8(13)5-9(14)11(10)12(15)18/h5-7,17H,3-4H2,1-2H3,(H2,15,18) |
| InChIKey | IWQYISVZCLMSJN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |