C19H22N4O2 — CID 133441834
6-[[2-(cyclopropylmethylamino)-2-oxoethyl]amino]-N-(4-methylphenyl)pyridine-3-carboxamide (PubChem CID 133441834) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 6-[[2-(cyclopropylmethylamino)-2-oxoethyl]amino]-N-(4-methylphenyl)pyridine-3-carboxamide.
| Compound Name | 6-[[2-(cyclopropylmethylamino)-2-oxoethyl]amino]-N-(4-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133441834 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 6-[[2-(cyclopropylmethylamino)-2-oxoethyl]amino]-N-(4-methylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(NCC(=O)NCC3CC3)nc2)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-13-2-7-16(8-3-13)23-19(25)15-6-9-17(20-11-15)21-12-18(24)22-10-14-4-5-14/h2-3,6-9,11,14H,4-5,10,12H2,1H3,(H,20,21)(H,22,24)(H,23,25) |
| InChIKey | YDQVDWHZRCJKFK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |