C17H16N4O3 — CID 46507746
6-[(2,5-dioxopyrrolidin-1-yl)amino]-N-(4-methylphenyl)pyridine-3-carboxamide (PubChem CID 46507746) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 6-[(2,5-dioxopyrrolidin-1-yl)amino]-N-(4-methylphenyl)pyridine-3-carboxamide.
| Compound Name | 6-[(2,5-dioxopyrrolidin-1-yl)amino]-N-(4-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46507746 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 6-[(2,5-dioxopyrrolidin-1-yl)amino]-N-(4-methylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(NN3C(=O)CCC3=O)nc2)cc1 |
| InChI | InChI=1S/C17H16N4O3/c1-11-2-5-13(6-3-11)19-17(24)12-4-7-14(18-10-12)20-21-15(22)8-9-16(21)23/h2-7,10H,8-9H2,1H3,(H,18,20)(H,19,24) |
| InChIKey | CUXLIOIYZUTDDA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|