C20H26N4O2 — CID 133326827
6-[2-(2,2-dimethylpropanoylamino)ethylamino]-N-(4-methylphenyl)pyridine-3-carboxamide (PubChem CID 133326827) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 6-[2-(2,2-dimethylpropanoylamino)ethylamino]-N-(4-methylphenyl)pyridine-3-carboxamide.
| Compound Name | 6-[2-(2,2-dimethylpropanoylamino)ethylamino]-N-(4-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133326827 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 6-[2-(2,2-dimethylpropanoylamino)ethylamino]-N-(4-methylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(NCCNC(=O)C(C)(C)C)nc2)cc1 |
| InChI | InChI=1S/C20H26N4O2/c1-14-5-8-16(9-6-14)24-18(25)15-7-10-17(23-13-15)21-11-12-22-19(26)20(2,3)4/h5-10,13H,11-12H2,1-4H3,(H,21,23)(H,22,26)(H,24,25) |
| InChIKey | WOTOFYXMEGWIJZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|