C15H21Cl2N3O3 — CID 133443142
2,6-dichloro-N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4-nitroaniline (PubChem CID 133443142) has the molecular formula C15H21Cl2N3O3 and a molecular weight of 362.26 g/mol. Its IUPAC name is 2,6-dichloro-N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4-nitroaniline.
| Compound Name | 2,6-dichloro-N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 133443142 |
| Molecular Formula | C15H21Cl2N3O3 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2,6-dichloro-N-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4-nitroaniline |
| SMILES | COCCN1CCC(CNc2c(Cl)cc([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C15H21Cl2N3O3/c1-23-7-6-19-4-2-11(3-5-19)10-18-15-13(16)8-12(20(21)22)9-14(15)17/h8-9,11,18H,2-7,10H2,1H3 |
| InChIKey | ZFCXBBVUHCWVAZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|