C14H15Cl2N3O3 — CID 91661014
1-cyclopropyl-4-[(2,6-dichloro-4-nitroanilino)methyl]pyrrolidin-2-one (PubChem CID 91661014) has the molecular formula C14H15Cl2N3O3 and a molecular weight of 344.20 g/mol. Its IUPAC name is 1-cyclopropyl-4-[(2,6-dichloro-4-nitroanilino)methyl]pyrrolidin-2-one.
| Compound Name | 1-cyclopropyl-4-[(2,6-dichloro-4-nitroanilino)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 91661014 |
| Molecular Formula | C14H15Cl2N3O3 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 1-cyclopropyl-4-[(2,6-dichloro-4-nitroanilino)methyl]pyrrolidin-2-one |
| SMILES | O=C1CC(CNc2c(Cl)cc([N+](=O)[O-])cc2Cl)CN1C1CC1 |
| InChI | InChI=1S/C14H15Cl2N3O3/c15-11-4-10(19(21)22)5-12(16)14(11)17-6-8-3-13(20)18(7-8)9-1-2-9/h4-5,8-9,17H,1-3,6-7H2 |
| InChIKey | PJJQMJZFAJYPPE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|