C12H15Cl2N3O2 — CID 106891755
2,6-dichloro-4-nitro-N-(piperidin-3-ylmethyl)aniline (PubChem CID 106891755) has the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.18 g/mol. Its IUPAC name is 2,6-dichloro-4-nitro-N-(piperidin-3-ylmethyl)aniline.
| Compound Name | 2,6-dichloro-4-nitro-N-(piperidin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 106891755 |
| Molecular Formula | C12H15Cl2N3O2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2,6-dichloro-4-nitro-N-(piperidin-3-ylmethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(Cl)c(NCC2CCCNC2)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N3O2/c13-10-4-9(17(18)19)5-11(14)12(10)16-7-8-2-1-3-15-6-8/h4-5,8,15-16H,1-3,6-7H2 |
| InChIKey | RKMZHYBVQXCZCL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|