C12H15F2N3O2 — CID 80554250
2,4-difluoro-5-nitro-N-(piperidin-3-ylmethyl)aniline (PubChem CID 80554250) has the molecular formula C12H15F2N3O2 and a molecular weight of 271.27 g/mol. Its IUPAC name is 2,4-difluoro-5-nitro-N-(piperidin-3-ylmethyl)aniline.
| Compound Name | 2,4-difluoro-5-nitro-N-(piperidin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 80554250 |
| Molecular Formula | C12H15F2N3O2 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2,4-difluoro-5-nitro-N-(piperidin-3-ylmethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(NCC2CCCNC2)c(F)cc1F |
| InChI | InChI=1S/C12H15F2N3O2/c13-9-4-10(14)12(17(18)19)5-11(9)16-7-8-2-1-3-15-6-8/h4-5,8,15-16H,1-3,6-7H2 |
| InChIKey | VWUVWGUVYAAFQT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|