C19H22FN3O2 — CID 21061670
4-N-(cyclohexylmethyl)-2-fluoro-5-nitro-1-N-phenylbenzene-1,4-diamine (PubChem CID 21061670) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 4-N-(cyclohexylmethyl)-2-fluoro-5-nitro-1-N-phenylbenzene-1,4-diamine.
| Compound Name | 4-N-(cyclohexylmethyl)-2-fluoro-5-nitro-1-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 21061670 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 4-N-(cyclohexylmethyl)-2-fluoro-5-nitro-1-N-phenylbenzene-1,4-diamine |
| SMILES | O=[N+]([O-])c1cc(Nc2ccccc2)c(F)cc1NCC1CCCCC1 |
| InChI | InChI=1S/C19H22FN3O2/c20-16-11-18(21-13-14-7-3-1-4-8-14)19(23(24)25)12-17(16)22-15-9-5-2-6-10-15/h2,5-6,9-12,14,21-22H,1,3-4,7-8,13H2 |
| InChIKey | BVUKOJYILMCZHJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|