C14H20N6O2 — CID 133445721
6-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methylamino]-N-methylpyridazine-3-carboxamide (PubChem CID 133445721) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 6-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methylamino]-N-methylpyridazine-3-carboxamide.
| Compound Name | 6-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methylamino]-N-methylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 133445721 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 6-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methylamino]-N-methylpyridazine-3-carboxamide |
| SMILES | CCc1nn(C)c(OC)c1CNc1ccc(C(=O)NC)nn1 |
| InChI | InChI=1S/C14H20N6O2/c1-5-10-9(14(22-4)20(3)19-10)8-16-12-7-6-11(17-18-12)13(21)15-2/h6-7H,5,8H2,1-4H3,(H,15,21)(H,16,18) |
| InChIKey | FVURUBUBYADFDU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |