C14H19N5O3 — CID 133445681
methyl 6-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methylamino]pyridazine-3-carboxylate (PubChem CID 133445681) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is methyl 6-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methylamino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methylamino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 133445681 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | methyl 6-[(3-ethyl-5-methoxy-1-methylpyrazol-4-yl)methylamino]pyridazine-3-carboxylate |
| SMILES | CCc1nn(C)c(OC)c1CNc1ccc(C(=O)OC)nn1 |
| InChI | InChI=1S/C14H19N5O3/c1-5-10-9(13(21-3)19(2)18-10)8-15-12-7-6-11(16-17-12)14(20)22-4/h6-7H,5,8H2,1-4H3,(H,15,17) |
| InChIKey | GECHOZHCTDJPTB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |