C12H19N3O2 — CID 133446960
3-(2,6-dimethylmorpholin-4-yl)-1-ethylpyrazin-2-one (PubChem CID 133446960) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-1-ethylpyrazin-2-one.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-1-ethylpyrazin-2-one |
|---|---|
| PubChem CID | 133446960 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-1-ethylpyrazin-2-one |
| SMILES | CCn1ccnc(N2CC(C)OC(C)C2)c1=O |
| InChI | InChI=1S/C12H19N3O2/c1-4-14-6-5-13-11(12(14)16)15-7-9(2)17-10(3)8-15/h5-6,9-10H,4,7-8H2,1-3H3 |
| InChIKey | XBSAYGAGCCFIJH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |