C12H20N4O — CID 64983518
3-(2,5-dimethylpiperazin-1-yl)-1-ethylpyrazin-2-one (PubChem CID 64983518) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-(2,5-dimethylpiperazin-1-yl)-1-ethylpyrazin-2-one.
| Compound Name | 3-(2,5-dimethylpiperazin-1-yl)-1-ethylpyrazin-2-one |
|---|---|
| PubChem CID | 64983518 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-(2,5-dimethylpiperazin-1-yl)-1-ethylpyrazin-2-one |
| SMILES | CCn1ccnc(N2CC(C)NCC2C)c1=O |
| InChI | InChI=1S/C12H20N4O/c1-4-15-6-5-13-11(12(15)17)16-8-9(2)14-7-10(16)3/h5-6,9-10,14H,4,7-8H2,1-3H3 |
| InChIKey | BPKWTXPMTSDTGR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |