C20H30N6 — CID 133447374
2-(2-methylimidazol-1-yl)-6-[3-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]pyrazine (PubChem CID 133447374) has the molecular formula C20H30N6 and a molecular weight of 354.50 g/mol. Its IUPAC name is 2-(2-methylimidazol-1-yl)-6-[3-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]pyrazine.
| Compound Name | 2-(2-methylimidazol-1-yl)-6-[3-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]pyrazine |
|---|---|
| PubChem CID | 133447374 |
| Molecular Formula | C20H30N6 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 2-(2-methylimidazol-1-yl)-6-[3-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]pyrazine |
| SMILES | Cc1nccn1-c1cncc(N2CCCC(CN3CCC(C)CC3)C2)n1 |
| InChI | InChI=1S/C20H30N6/c1-16-5-9-24(10-6-16)14-18-4-3-8-25(15-18)19-12-21-13-20(23-19)26-11-7-22-17(26)2/h7,11-13,16,18H,3-6,8-10,14-15H2,1-2H3 |
| InChIKey | IIQLUJNTXPVWAW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |