C13H11IN2S — CID 13344830
N-(3-iodoprop-2-ynyl)-N-methyl-4-phenyl-1,3-thiazol-2-amine (PubChem CID 13344830) has the molecular formula C13H11IN2S and a molecular weight of 354.22 g/mol. Its IUPAC name is N-(3-iodoprop-2-ynyl)-N-methyl-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-(3-iodoprop-2-ynyl)-N-methyl-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 13344830 |
| Molecular Formula | C13H11IN2S |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | N-(3-iodoprop-2-ynyl)-N-methyl-4-phenyl-1,3-thiazol-2-amine |
| SMILES | CN(CC#CI)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C13H11IN2S/c1-16(9-5-8-14)13-15-12(10-17-13)11-6-3-2-4-7-11/h2-4,6-7,10H,9H2,1H3 |
| InChIKey | DTZCGIOWQJJUNU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|