C14H17BrN2OS — CID 133451582
3-[(5-bromo-6-methyl-2-pyridinyl)amino]-1-thiophen-2-ylbutan-1-ol (PubChem CID 133451582) has the molecular formula C14H17BrN2OS and a molecular weight of 341.27 g/mol. Its IUPAC name is 3-[(5-bromo-6-methyl-2-pyridinyl)amino]-1-thiophen-2-ylbutan-1-ol.
| Compound Name | 3-[(5-bromo-6-methyl-2-pyridinyl)amino]-1-thiophen-2-ylbutan-1-ol |
|---|---|
| PubChem CID | 133451582 |
| Molecular Formula | C14H17BrN2OS |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 3-[(5-bromo-6-methyl-2-pyridinyl)amino]-1-thiophen-2-ylbutan-1-ol |
| SMILES | Cc1nc(NC(C)CC(O)c2cccs2)ccc1Br |
| InChI | InChI=1S/C14H17BrN2OS/c1-9(8-12(18)13-4-3-7-19-13)16-14-6-5-11(15)10(2)17-14/h3-7,9,12,18H,8H2,1-2H3,(H,16,17) |
| InChIKey | QWSYIMPMTVAKIA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |