C15H23NO2S — CID 110026098
(Z)-N-(4-hydroxy-4-thiophen-2-ylbutan-2-yl)-2,3-dimethylpent-2-enamide (PubChem CID 110026098) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is (Z)-N-(4-hydroxy-4-thiophen-2-ylbutan-2-yl)-2,3-dimethylpent-2-enamide.
| Compound Name | (Z)-N-(4-hydroxy-4-thiophen-2-ylbutan-2-yl)-2,3-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 110026098 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (Z)-N-(4-hydroxy-4-thiophen-2-ylbutan-2-yl)-2,3-dimethylpent-2-enamide |
| SMILES | CC/C(C)=C(/C)C(=O)NC(C)CC(O)c1cccs1 |
| InChI | InChI=1S/C15H23NO2S/c1-5-10(2)12(4)15(18)16-11(3)9-13(17)14-7-6-8-19-14/h6-8,11,13,17H,5,9H2,1-4H3,(H,16,18)/b12-10- |
| InChIKey | JQQDPUNHXKWWJN-BENRWUELSA-N |
| XLogP | 3.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|