C22H22N2O3S — CID 99596184
1-(3-benzoylphenyl)-3-[(2R,4S)-4-hydroxy-4-thiophen-2-ylbutan-2-yl]urea (PubChem CID 99596184) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 1-(3-benzoylphenyl)-3-[(2R,4S)-4-hydroxy-4-thiophen-2-ylbutan-2-yl]urea.
| Compound Name | 1-(3-benzoylphenyl)-3-[(2R,4S)-4-hydroxy-4-thiophen-2-ylbutan-2-yl]urea |
|---|---|
| PubChem CID | 99596184 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-(3-benzoylphenyl)-3-[(2R,4S)-4-hydroxy-4-thiophen-2-ylbutan-2-yl]urea |
| SMILES | C[C@H](C[C@H](O)c1cccs1)NC(=O)Nc1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H22N2O3S/c1-15(13-19(25)20-11-6-12-28-20)23-22(27)24-18-10-5-9-17(14-18)21(26)16-7-3-2-4-8-16/h2-12,14-15,19,25H,13H2,1H3,(H2,23,24,27)/t15-,19+/m1/s1 |
| InChIKey | UDIOIHXCIPIDDH-BEFAXECRSA-N |
| XLogP | 4.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |