C19H15FN2O2 — CID 133456835
4-acetyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methylamino]benzonitrile (PubChem CID 133456835) has the molecular formula C19H15FN2O2 and a molecular weight of 322.34 g/mol. Its IUPAC name is 4-acetyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methylamino]benzonitrile.
| Compound Name | 4-acetyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 133456835 |
| Molecular Formula | C19H15FN2O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-acetyl-2-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methylamino]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)c(NCc2oc3ccc(F)cc3c2C)c1 |
| InChI | InChI=1S/C19H15FN2O2/c1-11-16-8-15(20)5-6-18(16)24-19(11)10-22-17-7-13(12(2)23)3-4-14(17)9-21/h3-8,22H,10H2,1-2H3 |
| InChIKey | ZYPZOFIPZFNJRH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |