C14H21N3O — CID 133462019
N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-6-ethyl-2-methylpyrimidin-4-amine (PubChem CID 133462019) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-6-ethyl-2-methylpyrimidin-4-amine.
| Compound Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-6-ethyl-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133462019 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-6-ethyl-2-methylpyrimidin-4-amine |
| SMILES | CCc1cc(NCCC2=CCOCC2)nc(C)n1 |
| InChI | InChI=1S/C14H21N3O/c1-3-13-10-14(17-11(2)16-13)15-7-4-12-5-8-18-9-6-12/h5,10H,3-4,6-9H2,1-2H3,(H,15,16,17) |
| InChIKey | FHCLRTTYMXGMAS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|