C16H19N5O5 — CID 133463468
[4-[methyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-3-nitrophenyl]-morpholin-4-ylmethanone (PubChem CID 133463468) has the molecular formula C16H19N5O5 and a molecular weight of 361.36 g/mol. Its IUPAC name is [4-[methyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-3-nitrophenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[methyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-3-nitrophenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 133463468 |
| Molecular Formula | C16H19N5O5 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [4-[methyl-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]amino]-3-nitrophenyl]-morpholin-4-ylmethanone |
| SMILES | Cc1nc(CN(C)c2ccc(C(=O)N3CCOCC3)cc2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C16H19N5O5/c1-11-17-15(18-26-11)10-19(2)13-4-3-12(9-14(13)21(23)24)16(22)20-5-7-25-8-6-20/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | QEXXBEYUHMIMFQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 114.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|